C21H19Cl2N3O — CID 71199867
[(2S)-1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 71199867) has the molecular formula C21H19Cl2N3O and a molecular weight of 400.31 g/mol. Its IUPAC name is [(2S)-1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 71199867 |
| Molecular Formula | C21H19Cl2N3O |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [(2S)-1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1c1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H19Cl2N3O/c22-16-7-3-14(4-8-16)20-21(15-5-9-17(23)10-6-15)25-19(12-24-20)26-11-1-2-18(26)13-27/h3-10,12,18,27H,1-2,11,13H2/t18-/m0/s1 |
| InChIKey | PRODIZYBJPTHAE-SFHVURJKSA-N |
| XLogP | 5.08 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |