C24H26Cl2N4 — CID 143313402
1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N,N-diethylpyrrolidin-3-amine (PubChem CID 143313402) has the molecular formula C24H26Cl2N4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N,N-diethylpyrrolidin-3-amine.
| Compound Name | 1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N,N-diethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 143313402 |
| Molecular Formula | C24H26Cl2N4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N,N-diethylpyrrolidin-3-amine |
| SMILES | CCN(CC)C1CCN(c2cnc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C24H26Cl2N4/c1-3-29(4-2)21-13-14-30(16-21)22-15-27-23(17-5-9-19(25)10-6-17)24(28-22)18-7-11-20(26)12-8-18/h5-12,15,21H,3-4,13-14,16H2,1-2H3 |
| InChIKey | NBHVHDGYIKMFBU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |