About 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane
1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane (PubChem CID 143313316) has the molecular formula C28H26Cl2N4
and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane |
| PubChem CID | 143313316 |
| Molecular Formula | C28H26Cl2N4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane |
| SMILES | Clc1ccc(-c2ncc(N3CCCN(Cc4ccccc4)CC3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26Cl2N4/c29-24-11-7-22(8-12-24)27-28(23-9-13-25(30)14-10-23)32-26(19-31-27)34-16-4-15-33(17-18-34)20-21-5-2-1-3-6-21/h1-3,5-14,19H,4,15-18,20H2 |
| InChIKey | FGYDVGIOOYGOOL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane?
The IUPAC name of 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane (CID 143313316) is 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane.
What is the SMILES notation for 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane?
The canonical SMILES for 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane is Clc1ccc(-c2ncc(N3CCCN(Cc4ccccc4)CC3)nc2-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane?
The InChIKey is FGYDVGIOOYGOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26Cl2N4/c29-24-11-7-22(8-12-24)27-28(23-9-13-25(30)14-10-23)32-26(19-31-27)34-16-4-15-33(17-18-34)20-21-5-2-1-3-6-21/h1-3,5-14,19H,4,15-18,20H2.
What are the key properties of 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane?
1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane has a molecular weight of 489.45 g/mol, XLogP of 6.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-1,4-diazepane is sourced from PubChem (CID 143313316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).