C27H24Cl2N4 — CID 71199842
N-[(3R)-1-benzylpyrrolidin-3-yl]-5,6-bis(4-chlorophenyl)pyrazin-2-amine (PubChem CID 71199842) has the molecular formula C27H24Cl2N4 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[(3R)-1-benzylpyrrolidin-3-yl]-5,6-bis(4-chlorophenyl)pyrazin-2-amine.
| Compound Name | N-[(3R)-1-benzylpyrrolidin-3-yl]-5,6-bis(4-chlorophenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 71199842 |
| Molecular Formula | C27H24Cl2N4 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[(3R)-1-benzylpyrrolidin-3-yl]-5,6-bis(4-chlorophenyl)pyrazin-2-amine |
| SMILES | Clc1ccc(-c2ncc(N[C@@H]3CCN(Cc4ccccc4)C3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H24Cl2N4/c28-22-10-6-20(7-11-22)26-27(21-8-12-23(29)13-9-21)32-25(16-30-26)31-24-14-15-33(18-24)17-19-4-2-1-3-5-19/h1-13,16,24H,14-15,17-18H2,(H,31,32)/t24-/m1/s1 |
| InChIKey | PAUYCYOOPYJBAY-XMMPIXPASA-N |
| XLogP | 6.80 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |