C22H22ClN3S — CID 144961575
N-[(5-chloro-2-pyridinyl)sulfanyl]-1-[(4-phenylphenyl)methyl]pyrrolidin-3-amine (PubChem CID 144961575) has the molecular formula C22H22ClN3S and a molecular weight of 395.96 g/mol. Its IUPAC name is N-[(5-chloro-2-pyridinyl)sulfanyl]-1-[(4-phenylphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | N-[(5-chloro-2-pyridinyl)sulfanyl]-1-[(4-phenylphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 144961575 |
| Molecular Formula | C22H22ClN3S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(5-chloro-2-pyridinyl)sulfanyl]-1-[(4-phenylphenyl)methyl]pyrrolidin-3-amine |
| SMILES | Clc1ccc(SNC2CCN(Cc3ccc(-c4ccccc4)cc3)C2)nc1 |
| InChI | InChI=1S/C22H22ClN3S/c23-20-10-11-22(24-14-20)27-25-21-12-13-26(16-21)15-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-11,14,21,25H,12-13,15-16H2 |
| InChIKey | IMUHQUJAJJNLSW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|