C20H26N4OS — CID 166097327
1-benzyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfanyl]pyrrolidin-3-amine (PubChem CID 166097327) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-benzyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfanyl]pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfanyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 166097327 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-benzyl-N-[(6-morpholin-4-yl-3-pyridinyl)sulfanyl]pyrrolidin-3-amine |
| SMILES | c1ccc(CN2CCC(NSc3ccc(N4CCOCC4)nc3)C2)cc1 |
| InChI | InChI=1S/C20H26N4OS/c1-2-4-17(5-3-1)15-23-9-8-18(16-23)22-26-19-6-7-20(21-14-19)24-10-12-25-13-11-24/h1-7,14,18,22H,8-13,15-16H2 |
| InChIKey | CMVUNEXXOLJTLZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|