C22H28N4O2 — CID 55986688
1-benzyl-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-3-carboxamide (PubChem CID 55986688) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-benzyl-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55986688 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-benzyl-N-(6-morpholin-4-yl-3-pyridinyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H28N4O2/c27-22(19-7-4-10-25(17-19)16-18-5-2-1-3-6-18)24-20-8-9-21(23-15-20)26-11-13-28-14-12-26/h1-3,5-6,8-9,15,19H,4,7,10-14,16-17H2,(H,24,27) |
| InChIKey | HYZNBVSEPLEQNY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |