C20H28N6O — CID 117085878
4-N-(1-benzylpiperidin-4-yl)-6-morpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 117085878) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-4-yl)-6-morpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-benzylpiperidin-4-yl)-6-morpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117085878 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-N-(1-benzylpiperidin-4-yl)-6-morpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC2CCN(Cc3ccccc3)CC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H28N6O/c21-20-23-18(14-19(24-20)26-10-12-27-13-11-26)22-17-6-8-25(9-7-17)15-16-4-2-1-3-5-16/h1-5,14,17H,6-13,15H2,(H3,21,22,23,24) |
| InChIKey | GFHUEMDBFLBXGQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |