C20H19N3O — CID 656281
4-(2,6-diphenylpyrimidin-4-yl)morpholine (PubChem CID 656281) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(2,6-diphenylpyrimidin-4-yl)morpholine.
| Compound Name | 4-(2,6-diphenylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 656281 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-(2,6-diphenylpyrimidin-4-yl)morpholine |
| SMILES | c1ccc(-c2cc(N3CCOCC3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H19N3O/c1-3-7-16(8-4-1)18-15-19(23-11-13-24-14-12-23)22-20(21-18)17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | NHAXZOWPTAFHID-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |