C22H22ClN3O2S — CID 130225238
4-chloro-N-[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]pyridine-3-sulfonamide (PubChem CID 130225238) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]pyridine-3-sulfonamide.
| Compound Name | 4-chloro-N-[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 130225238 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-chloro-N-[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCN(Cc2ccc(-c3ccccc3)cc2)C1)c1cnccc1Cl |
| InChI | InChI=1S/C22H22ClN3O2S/c23-21-10-12-24-14-22(21)29(27,28)25-20-11-13-26(16-20)15-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-10,12,14,20,25H,11,13,15-16H2/t20-/m1/s1 |
| InChIKey | SDGYVBWYYFWYNN-HXUWFJFHSA-N |
| XLogP | 3.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |