C16H22N4O2S — CID 51499712
N-[(3S)-1-benzylpyrrolidin-3-yl]-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 51499712) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-3-yl]-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 51499712 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N[C@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H22N4O2S/c1-13-16(12-19(2)17-13)23(21,22)18-15-8-9-20(11-15)10-14-6-4-3-5-7-14/h3-7,12,15,18H,8-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | VOHNFWYXRSZKNX-HNNXBMFYSA-N |
| XLogP | 1.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |