C18H20Cl2N2O2S — CID 56581910
N-(1-benzylpyrrolidin-3-yl)-1-(3,4-dichlorophenyl)methanesulfonamide (PubChem CID 56581910) has the molecular formula C18H20Cl2N2O2S and a molecular weight of 399.34 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-1-(3,4-dichlorophenyl)methanesulfonamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-1-(3,4-dichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 56581910 |
| Molecular Formula | C18H20Cl2N2O2S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-1-(3,4-dichlorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)c(Cl)c1)NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H20Cl2N2O2S/c19-17-7-6-15(10-18(17)20)13-25(23,24)21-16-8-9-22(12-16)11-14-4-2-1-3-5-14/h1-7,10,16,21H,8-9,11-13H2 |
| InChIKey | FZQLYOUSLDGPMZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |