C24H22ClN3O2S — CID 130224703
N-[(3R)-1-[[4-(4-chlorophenyl)phenyl]methyl]pyrrolidin-3-yl]-3-cyanobenzenesulfonamide (PubChem CID 130224703) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-[(3R)-1-[[4-(4-chlorophenyl)phenyl]methyl]pyrrolidin-3-yl]-3-cyanobenzenesulfonamide.
| Compound Name | N-[(3R)-1-[[4-(4-chlorophenyl)phenyl]methyl]pyrrolidin-3-yl]-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 130224703 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[(3R)-1-[[4-(4-chlorophenyl)phenyl]methyl]pyrrolidin-3-yl]-3-cyanobenzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N[C@@H]2CCN(Cc3ccc(-c4ccc(Cl)cc4)cc3)C2)c1 |
| InChI | InChI=1S/C24H22ClN3O2S/c25-22-10-8-21(9-11-22)20-6-4-18(5-7-20)16-28-13-12-23(17-28)27-31(29,30)24-3-1-2-19(14-24)15-26/h1-11,14,23,27H,12-13,16-17H2/t23-/m1/s1 |
| InChIKey | PTMZRDKMZVXMED-HSZRJFAPSA-N |
| XLogP | 4.43 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |