C26H27N3O3S — CID 10115587
N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 10115587) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10115587 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(-c2ccc(OCCCN3CC[C@@H](NS(=O)(=O)c4ccccc4)C3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O3S/c27-19-21-7-9-22(10-8-21)23-11-13-25(14-12-23)32-18-4-16-29-17-15-24(20-29)28-33(30,31)26-5-2-1-3-6-26/h1-3,5-14,24,28H,4,15-18,20H2/t24-/m1/s1 |
| InChIKey | GEWNYUDBRSFNJQ-XMMPIXPASA-N |
| XLogP | 4.05 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|