C30H35N3O3S — CID 69355786
4-tert-butyl-N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]benzenesulfonamide (PubChem CID 69355786) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 69355786 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 4-tert-butyl-N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NC2CCCN2CCCOc2ccc(-c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O3S/c1-30(2,3)26-13-17-28(18-14-26)37(34,35)32-29-6-4-19-33(29)20-5-21-36-27-15-11-25(12-16-27)24-9-7-23(22-31)8-10-24/h7-18,29,32H,4-6,19-21H2,1-3H3 |
| InChIKey | BOUCCLJBVCCNCJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|