C22H25N3O3 — CID 22994364
[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-methylcarbamic acid (PubChem CID 22994364) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is [1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-methylcarbamic acid.
| Compound Name | [1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 22994364 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCCN1CCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-24(22(26)27)21-4-2-13-25(21)14-3-15-28-20-11-9-19(10-12-20)18-7-5-17(16-23)6-8-18/h5-12,21H,2-4,13-15H2,1H3,(H,26,27) |
| InChIKey | LHLHYXPHZMMVSG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|