C28H28FN3O2 — CID 69355815
N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-4-fluoro-N-methylbenzamide (PubChem CID 69355815) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-4-fluoro-N-methylbenzamide.
| Compound Name | N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-4-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 69355815 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-4-fluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)cc1)C1CCCN1CCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C28H28FN3O2/c1-31(28(33)24-9-13-25(29)14-10-24)27-4-2-17-32(27)18-3-19-34-26-15-11-23(12-16-26)22-7-5-21(20-30)6-8-22/h5-16,27H,2-4,17-19H2,1H3 |
| InChIKey | PZULOVJEOXDABJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|