C30H38N5O3+ — CID 90952195
1-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-N-(pyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 90952195) has the molecular formula C30H38N5O3+ and a molecular weight of 516.67 g/mol. Its IUPAC name is 1-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-N-(pyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | 1-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-N-(pyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 90952195 |
| Molecular Formula | C30H38N5O3+ |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-[1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-2-yl]-N-(pyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | N#Cc1ccc(-c2ccc(OCCCN3CCCC3[N+]3(C(=O)NC(=O)N4CCCC4)CCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H37N5O3/c31-23-24-8-10-25(11-9-24)26-12-14-27(15-13-26)38-22-6-19-33-18-5-7-28(33)35(20-3-4-21-35)30(37)32-29(36)34-16-1-2-17-34/h8-15,28H,1-7,16-22H2/p+1 |
| InChIKey | RUBZXSOJHUCFGH-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|