C27H29N3O4S — CID 10206738
N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-4-methoxybenzenesulfonamide (PubChem CID 10206738) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 10206738 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H]2CCN(CCCOc3ccc(-c4ccc(C#N)cc4)cc3)C2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-33-25-11-13-27(14-12-25)35(31,32)29-24-15-17-30(20-24)16-2-18-34-26-9-7-23(8-10-26)22-5-3-21(19-28)4-6-22/h3-14,24,29H,2,15-18,20H2,1H3/t24-/m1/s1 |
| InChIKey | XHFYKBOHQWYNHB-XMMPIXPASA-N |
| XLogP | 4.06 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|