C29H28ClN3O3S2 — CID 10303306
5-chloro-N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-3-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 10303306) has the molecular formula C29H28ClN3O3S2 and a molecular weight of 566.15 g/mol. Its IUPAC name is 5-chloro-N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-3-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-3-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10303306 |
| Molecular Formula | C29H28ClN3O3S2 |
| Molecular Weight | 566.15 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 5-chloro-N-[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]-3-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)N[C@@H]2CCN(CCCOc3ccc(-c4ccc(C#N)cc4)cc3)C2)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C29H28ClN3O3S2/c1-20-27-17-24(30)9-12-28(27)37-29(20)38(34,35)32-25-13-15-33(19-25)14-2-16-36-26-10-7-23(8-11-26)22-5-3-21(18-31)4-6-22/h3-12,17,25,32H,2,13-16,19H2,1H3/t25-/m1/s1 |
| InChIKey | KEKIHJDQIBJEID-RUZDIDTESA-N |
| XLogP | 6.22 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.15 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|