C26H29N5O4S2 — CID 10187150
N-[5-[[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 10187150) has the molecular formula C26H29N5O4S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[5-[[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 10187150 |
| Molecular Formula | C26H29N5O4S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[5-[[(3R)-1-[3-[4-(4-cyanophenyl)phenoxy]propyl]pyrrolidin-3-yl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)N[C@@H]2CCN(CCCOc3ccc(-c4ccc(C#N)cc4)cc3)C2)s1 |
| InChI | InChI=1S/C26H29N5O4S2/c1-18-25(36-26(28-18)29-19(2)32)37(33,34)30-23-12-14-31(17-23)13-3-15-35-24-10-8-22(9-11-24)21-6-4-20(16-27)5-7-21/h4-11,23,30H,3,12-15,17H2,1-2H3,(H,28,29,32)/t23-/m1/s1 |
| InChIKey | VMHIYJQAQIRUCP-HSZRJFAPSA-N |
| XLogP | 3.77 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|