C11H13ClN2O2 — CID 162728785
6-chloro-1-methylspiro[2H-pyrido[3,2-d][1,3]oxazine-4,3'-oxolane] (PubChem CID 162728785) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 6-chloro-1-methylspiro[2H-pyrido[3,2-d][1,3]oxazine-4,3'-oxolane].
| Compound Name | 6-chloro-1-methylspiro[2H-pyrido[3,2-d][1,3]oxazine-4,3'-oxolane] |
|---|---|
| PubChem CID | 162728785 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-chloro-1-methylspiro[2H-pyrido[3,2-d][1,3]oxazine-4,3'-oxolane] |
| SMILES | CN1COC2(CCOC2)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C11H13ClN2O2/c1-14-7-16-11(4-5-15-6-11)10-8(14)2-3-9(12)13-10/h2-3H,4-7H2,1H3 |
| InChIKey | RQSCVRFKNCORNN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|