C14H14O4 — CID 164899368
(E)-3-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylprop-2-enoic acid (PubChem CID 164899368) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (E)-3-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylprop-2-enoic acid.
| Compound Name | (E)-3-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 164899368 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (E)-3-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylprop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)COC21CCOC1 |
| InChI | InChI=1S/C14H14O4/c15-13(16)4-2-10-1-3-12-11(7-10)8-18-14(12)5-6-17-9-14/h1-4,7H,5-6,8-9H2,(H,15,16)/b4-2+ |
| InChIKey | CVJSBDVFTRUUOC-DUXPYHPUSA-N |
| XLogP | 1.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|