C11H12ClNO — CID 84677333
5-chlorospiro[1H-2-benzofuran-3,3'-pyrrolidine] (PubChem CID 84677333) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 5-chlorospiro[1H-2-benzofuran-3,3'-pyrrolidine].
| Compound Name | 5-chlorospiro[1H-2-benzofuran-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 84677333 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 5-chlorospiro[1H-2-benzofuran-3,3'-pyrrolidine] |
| SMILES | Clc1ccc2c(c1)C1(CCNC1)OC2 |
| InChI | InChI=1S/C11H12ClNO/c12-9-2-1-8-6-14-11(10(8)5-9)3-4-13-7-11/h1-2,5,13H,3-4,6-7H2 |
| InChIKey | IJCRUYAFGOHRCX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |