C19H21NO — CID 19045403
1'-benzylspiro[3H-1-benzofuran-2,3'-piperidine] (PubChem CID 19045403) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 1'-benzylspiro[3H-1-benzofuran-2,3'-piperidine].
| Compound Name | 1'-benzylspiro[3H-1-benzofuran-2,3'-piperidine] |
|---|---|
| PubChem CID | 19045403 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1'-benzylspiro[3H-1-benzofuran-2,3'-piperidine] |
| SMILES | c1ccc(CN2CCCC3(Cc4ccccc4O3)C2)cc1 |
| InChI | InChI=1S/C19H21NO/c1-2-7-16(8-3-1)14-20-12-6-11-19(15-20)13-17-9-4-5-10-18(17)21-19/h1-5,7-10H,6,11-15H2 |
| InChIKey | MGQNLYQAFGAIJK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |