C19H20N2O2 — CID 95799880
(2R)-1'-benzylspiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one (PubChem CID 95799880) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R)-1'-benzylspiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one.
| Compound Name | (2R)-1'-benzylspiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one |
|---|---|
| PubChem CID | 95799880 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2R)-1'-benzylspiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one |
| SMILES | O=C1N[C@]2(CCCN(Cc3ccccc3)C2)Oc2ccccc21 |
| InChI | InChI=1S/C19H20N2O2/c22-18-16-9-4-5-10-17(16)23-19(20-18)11-6-12-21(14-19)13-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2,(H,20,22)/t19-/m1/s1 |
| InChIKey | JMWMEVNWEDRLEI-LJQANCHMSA-N |
| XLogP | 2.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |