C22H22N2O4 — CID 123336038
3-(1'-benzyl-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl)prop-2-enoic acid (PubChem CID 123336038) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-(1'-benzyl-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl)prop-2-enoic acid.
| Compound Name | 3-(1'-benzyl-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 123336038 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-(1'-benzyl-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)C(=O)NC1(CCCN(Cc3ccccc3)C1)O2 |
| InChI | InChI=1S/C22H22N2O4/c25-20(26)10-8-16-7-9-19-18(13-16)21(27)23-22(28-19)11-4-12-24(15-22)14-17-5-2-1-3-6-17/h1-3,5-10,13H,4,11-12,14-15H2,(H,23,27)(H,25,26) |
| InChIKey | RCMLZCHLAMCYEA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|