C25H26N4O4 — CID 87258281
(E)-N-hydroxy-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl]prop-2-enamide (PubChem CID 87258281) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87258281 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (E)-N-hydroxy-3-[1'-[1-(1H-indol-3-yl)ethyl]-4-oxospiro[3H-1,3-benzoxazine-2,3'-piperidine]-6-yl]prop-2-enamide |
| SMILES | CC(c1c[nH]c2ccccc12)N1CCCC2(C1)NC(=O)c1cc(/C=C/C(=O)NO)ccc1O2 |
| InChI | InChI=1S/C25H26N4O4/c1-16(20-14-26-21-6-3-2-5-18(20)21)29-12-4-11-25(15-29)27-24(31)19-13-17(7-9-22(19)33-25)8-10-23(30)28-32/h2-3,5-10,13-14,16,26,32H,4,11-12,15H2,1H3,(H,27,31)(H,28,30)/b10-8+ |
| InChIKey | JHICWMSQYJMDCB-CSKARUKUSA-N |
| XLogP | 3.36 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|