C16H19ClN2O4 — CID 66932409
methyl 3-(4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate;hydrochloride (PubChem CID 66932409) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 3-(4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate;hydrochloride.
| Compound Name | methyl 3-(4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 66932409 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 3-(4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate;hydrochloride |
| SMILES | COC(=O)C=Cc1ccc2c(c1)C(=O)NC1(CCNCC1)O2.Cl |
| InChI | InChI=1S/C16H18N2O4.ClH/c1-21-14(19)5-3-11-2-4-13-12(10-11)15(20)18-16(22-13)6-8-17-9-7-16;/h2-5,10,17H,6-9H2,1H3,(H,18,20);1H |
| InChIKey | PEWBPCUOIHHGDD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|