C12H8O5 — CID 169479515
methyl 3-(1,3-dioxo-2-benzofuran-5-yl)prop-2-enoate (PubChem CID 169479515) has the molecular formula C12H8O5 and a molecular weight of 232.19 g/mol. Its IUPAC name is methyl 3-(1,3-dioxo-2-benzofuran-5-yl)prop-2-enoate.
| Compound Name | methyl 3-(1,3-dioxo-2-benzofuran-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 169479515 |
| Molecular Formula | C12H8O5 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | methyl 3-(1,3-dioxo-2-benzofuran-5-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C12H8O5/c1-16-10(13)5-3-7-2-4-8-9(6-7)12(15)17-11(8)14/h2-6H,1H3 |
| InChIKey | PVUBDJUVZQJSFF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|