C17H20N2O4 — CID 66932522
methyl 3-(3-methyl-4-oxospiro[1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate (PubChem CID 66932522) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 3-(3-methyl-4-oxospiro[1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate.
| Compound Name | methyl 3-(3-methyl-4-oxospiro[1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 66932522 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 3-(3-methyl-4-oxospiro[1,3-benzoxazine-2,4'-piperidine]-6-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)C(=O)N(C)C1(CCNCC1)O2 |
| InChI | InChI=1S/C17H20N2O4/c1-19-16(21)13-11-12(4-6-15(20)22-2)3-5-14(13)23-17(19)7-9-18-10-8-17/h3-6,11,18H,7-10H2,1-2H3 |
| InChIKey | FBDGQROWPHQQPJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|