C21H26N2O — CID 95854167
(2S)-1'-benzylspiro[4,5-dihydro-3H-1,4-benzoxazepine-2,4'-azepane] (PubChem CID 95854167) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S)-1'-benzylspiro[4,5-dihydro-3H-1,4-benzoxazepine-2,4'-azepane].
| Compound Name | (2S)-1'-benzylspiro[4,5-dihydro-3H-1,4-benzoxazepine-2,4'-azepane] |
|---|---|
| PubChem CID | 95854167 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (2S)-1'-benzylspiro[4,5-dihydro-3H-1,4-benzoxazepine-2,4'-azepane] |
| SMILES | c1ccc(CN2CCC[C@]3(CC2)CNCc2ccccc2O3)cc1 |
| InChI | InChI=1S/C21H26N2O/c1-2-7-18(8-3-1)16-23-13-6-11-21(12-14-23)17-22-15-19-9-4-5-10-20(19)24-21/h1-5,7-10,22H,6,11-17H2/t21-/m0/s1 |
| InChIKey | HGUVJQWYQSMLET-NRFANRHFSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |