About 2H-chromene;fluoromethane
2H-chromene;fluoromethane (PubChem CID 88608923) has the molecular formula C10H11FO
and a molecular weight of 166.19 g/mol. Its IUPAC name is 2H-chromene;fluoromethane.
Molecular Properties
| Compound Name | 2H-chromene;fluoromethane |
| PubChem CID | 88608923 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2H-chromene;fluoromethane |
| SMILES | C1=Cc2ccccc2OC1.CF |
| InChI | InChI=1S/C9H8O.CH3F/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h1-6H,7H2;1H3 |
| InChIKey | LDIBPHAJRKHGDX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-chromene;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;fluoromethane?
The IUPAC name of 2H-chromene;fluoromethane (CID 88608923) is 2H-chromene;fluoromethane.
What is the SMILES notation for 2H-chromene;fluoromethane?
The canonical SMILES for 2H-chromene;fluoromethane is C1=Cc2ccccc2OC1.CF.
What is the InChIKey of 2H-chromene;fluoromethane?
The InChIKey is LDIBPHAJRKHGDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.CH3F/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h1-6H,7H2;1H3.
What are the key properties of 2H-chromene;fluoromethane?
2H-chromene;fluoromethane has a molecular weight of 166.19 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;fluoromethane is sourced from PubChem (CID 88608923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).