C16H13NO4S — CID 143817255
1,4-benzodioxin-3-one;4H-1,4-benzoxazine-3-thione (PubChem CID 143817255) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 1,4-benzodioxin-3-one;4H-1,4-benzoxazine-3-thione.
| Compound Name | 1,4-benzodioxin-3-one;4H-1,4-benzoxazine-3-thione |
|---|---|
| PubChem CID | 143817255 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 1,4-benzodioxin-3-one;4H-1,4-benzoxazine-3-thione |
| SMILES | O=C1COc2ccccc2O1.S=C1COc2ccccc2N1 |
| InChI | InChI=1S/C8H7NOS.C8H6O3/c11-8-5-10-7-4-2-1-3-6(7)9-8;9-8-5-10-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H,9,11);1-4H,5H2 |
| InChIKey | BJNWUHKXAPANML-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|