About 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide
1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide (PubChem CID 43479138) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide |
| PubChem CID | 43479138 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2cc3c(cc2N)OCC(=O)N3)C1 |
| InChI | InChI=1S/C14H18N4O3/c15-9-4-12-10(17-13(19)7-21-12)5-11(9)18-3-1-2-8(6-18)14(16)20/h4-5,8H,1-3,6-7,15H2,(H2,16,20)(H,17,19) |
| InChIKey | RXSMPUDYFMSFPU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide?
The IUPAC name of 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide (CID 43479138) is 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide?
The canonical SMILES for 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide is NC(=O)C1CCCN(c2cc3c(cc2N)OCC(=O)N3)C1.
What is the InChIKey of 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide?
The InChIKey is RXSMPUDYFMSFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c15-9-4-12-10(17-13(19)7-21-12)5-11(9)18-3-1-2-8(6-18)14(16)20/h4-5,8H,1-3,6-7,15H2,(H2,16,20)(H,17,19).
What are the key properties of 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide?
1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide has a molecular weight of 290.32 g/mol, XLogP of 0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)piperidine-3-carboxamide is sourced from PubChem (CID 43479138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).