C14H18ClF2NS — CID 107456779
4-[4-(chloromethyl)-2,6-difluorophenyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107456779) has the molecular formula C14H18ClF2NS and a molecular weight of 305.82 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-2,6-difluorophenyl]-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[4-(chloromethyl)-2,6-difluorophenyl]-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107456779 |
| Molecular Formula | C14H18ClF2NS |
| Molecular Weight | 305.82 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[4-(chloromethyl)-2,6-difluorophenyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(c2c(F)cc(CCl)cc2F)CCS1 |
| InChI | InChI=1S/C14H18ClF2NS/c1-14(2)3-4-18(5-6-19-14)13-11(16)7-10(9-15)8-12(13)17/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | OQSHKEBAXLDMMC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|