C15H22FNOS — CID 107456630
(1S)-1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorophenyl]ethanol (PubChem CID 107456630) has the molecular formula C15H22FNOS and a molecular weight of 283.41 g/mol. Its IUPAC name is (1S)-1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 107456630 |
| Molecular Formula | C15H22FNOS |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1S)-1-[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluorophenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N2CCSC(C)(C)CC2)c(F)c1 |
| InChI | InChI=1S/C15H22FNOS/c1-11(18)12-4-5-14(13(16)10-12)17-7-6-15(2,3)19-9-8-17/h4-5,10-11,18H,6-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | OEKGOIADKZLVTA-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|