C14H19BrFNS — CID 107456786
4-[2-(bromomethyl)-4-fluorophenyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107456786) has the molecular formula C14H19BrFNS and a molecular weight of 332.28 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-4-fluorophenyl]-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[2-(bromomethyl)-4-fluorophenyl]-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107456786 |
| Molecular Formula | C14H19BrFNS |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[2-(bromomethyl)-4-fluorophenyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(c2ccc(F)cc2CBr)CCS1 |
| InChI | InChI=1S/C14H19BrFNS/c1-14(2)5-6-17(7-8-18-14)13-4-3-12(16)9-11(13)10-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | HWJLELAAMFQVOO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|