C13H19ClN2S — CID 107458305
4-[3-(chloromethyl)-4-pyridinyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458305) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 4-[3-(chloromethyl)-4-pyridinyl]-7,7-dimethyl-1,4-thiazepane.
| Compound Name | 4-[3-(chloromethyl)-4-pyridinyl]-7,7-dimethyl-1,4-thiazepane |
|---|---|
| PubChem CID | 107458305 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[3-(chloromethyl)-4-pyridinyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(c2ccncc2CCl)CCS1 |
| InChI | InChI=1S/C13H19ClN2S/c1-13(2)4-6-16(7-8-17-13)12-3-5-15-10-11(12)9-14/h3,5,10H,4,6-9H2,1-2H3 |
| InChIKey | WZQXEJHMJJLGAW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|