C13H17BrClNS — CID 107085295
4-[2-(bromomethyl)-4-chlorophenyl]-2,2-dimethylthiomorpholine (PubChem CID 107085295) has the molecular formula C13H17BrClNS and a molecular weight of 334.71 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-4-chlorophenyl]-2,2-dimethylthiomorpholine.
| Compound Name | 4-[2-(bromomethyl)-4-chlorophenyl]-2,2-dimethylthiomorpholine |
|---|---|
| PubChem CID | 107085295 |
| Molecular Formula | C13H17BrClNS |
| Molecular Weight | 334.71 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 4-[2-(bromomethyl)-4-chlorophenyl]-2,2-dimethylthiomorpholine |
| SMILES | CC1(C)CN(c2ccc(Cl)cc2CBr)CCS1 |
| InChI | InChI=1S/C13H17BrClNS/c1-13(2)9-16(5-6-17-13)12-4-3-11(15)7-10(12)8-14/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | WAYQSRTZYYOKNC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|