C13H15ClN2S — CID 115682921
4-chloro-2-(2,2-dimethylthiomorpholin-4-yl)benzonitrile (PubChem CID 115682921) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethylthiomorpholin-4-yl)benzonitrile.
| Compound Name | 4-chloro-2-(2,2-dimethylthiomorpholin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 115682921 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-chloro-2-(2,2-dimethylthiomorpholin-4-yl)benzonitrile |
| SMILES | CC1(C)CN(c2cc(Cl)ccc2C#N)CCS1 |
| InChI | InChI=1S/C13H15ClN2S/c1-13(2)9-16(5-6-17-13)12-7-11(14)4-3-10(12)8-15/h3-4,7H,5-6,9H2,1-2H3 |
| InChIKey | OOLJVAVIVDTMEE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |