C17H23F2NO — CID 63078105
[4-(3-azaspiro[5.5]undecan-3-yl)-3,5-difluorophenyl]methanol (PubChem CID 63078105) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is [4-(3-azaspiro[5.5]undecan-3-yl)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(3-azaspiro[5.5]undecan-3-yl)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 63078105 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [4-(3-azaspiro[5.5]undecan-3-yl)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(N2CCC3(CCCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C17H23F2NO/c18-14-10-13(12-21)11-15(19)16(14)20-8-6-17(7-9-20)4-2-1-3-5-17/h10-11,21H,1-9,12H2 |
| InChIKey | BBMOWALTYPSQGJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|