C13H18F3N3O — CID 80734647
3-methoxy-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline (PubChem CID 80734647) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-methoxy-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline.
| Compound Name | 3-methoxy-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 80734647 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-methoxy-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
| SMILES | COc1cc(N)cc(N2CCN(CC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C13H18F3N3O/c1-20-12-7-10(17)6-11(8-12)19-4-2-18(3-5-19)9-13(14,15)16/h6-8H,2-5,9,17H2,1H3 |
| InChIKey | SAIICVJUNLXJHC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|