C14H21N3O3 — CID 69033368
2-[4-(3,5-dimethoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 69033368) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[4-(3,5-dimethoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | 2-[4-(3,5-dimethoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 69033368 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[4-(3,5-dimethoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1cc(OC)cc(N2CCN(CC(N)=O)CC2)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-19-12-7-11(8-13(9-12)20-2)17-5-3-16(4-6-17)10-14(15)18/h7-9H,3-6,10H2,1-2H3,(H2,15,18) |
| InChIKey | QHUWITHWOYWFJM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |