About 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone
1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 104528796) has the molecular formula C14H18F3N3O
and a molecular weight of 301.31 g/mol. Its IUPAC name is 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone |
| PubChem CID | 104528796 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(CC(F)(F)F)CC2)cc1N |
| InChI | InChI=1S/C14H18F3N3O/c1-10(21)12-3-2-11(8-13(12)18)20-6-4-19(5-7-20)9-14(15,16)17/h2-3,8H,4-7,9,18H2,1H3 |
| InChIKey | LSVRTSBLDNMHHX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone?
The IUPAC name of 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone (CID 104528796) is 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone.
What is the SMILES notation for 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone?
The canonical SMILES for 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone is CC(=O)c1ccc(N2CCN(CC(F)(F)F)CC2)cc1N.
What is the InChIKey of 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone?
The InChIKey is LSVRTSBLDNMHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N3O/c1-10(21)12-3-2-11(8-13(12)18)20-6-4-19(5-7-20)9-14(15,16)17/h2-3,8H,4-7,9,18H2,1H3.
What are the key properties of 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone?
1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone has a molecular weight of 301.31 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-amino-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]ethanone is sourced from PubChem (CID 104528796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).