C12H15F3N4O2 — CID 58624651
2-nitro-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline (PubChem CID 58624651) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-nitro-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline.
| Compound Name | 2-nitro-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 58624651 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-nitro-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]aniline |
| SMILES | Nc1cc(N2CCN(CC(F)(F)F)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15F3N4O2/c13-12(14,15)8-17-3-5-18(6-4-17)9-1-2-11(19(20)21)10(16)7-9/h1-2,7H,3-6,8,16H2 |
| InChIKey | VILNUAFMVIJMKS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|