C12H18N4O2 — CID 21032416
5-[(3S)-3,4-dimethylpiperazin-1-yl]-2-nitroaniline (PubChem CID 21032416) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-[(3S)-3,4-dimethylpiperazin-1-yl]-2-nitroaniline.
| Compound Name | 5-[(3S)-3,4-dimethylpiperazin-1-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 21032416 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5-[(3S)-3,4-dimethylpiperazin-1-yl]-2-nitroaniline |
| SMILES | C[C@H]1CN(c2ccc([N+](=O)[O-])c(N)c2)CCN1C |
| InChI | InChI=1S/C12H18N4O2/c1-9-8-15(6-5-14(9)2)10-3-4-12(16(17)18)11(13)7-10/h3-4,7,9H,5-6,8,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | XCMWYISAUBYZDO-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|