About 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine
4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine (PubChem CID 21032415) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine |
| PubChem CID | 21032415 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine |
| SMILES | C[C@H]1CN(c2ccc(N)c(N)c2)CCN1C |
| InChI | InChI=1S/C12H20N4/c1-9-8-16(6-5-15(9)2)10-3-4-11(13)12(14)7-10/h3-4,7,9H,5-6,8,13-14H2,1-2H3/t9-/m0/s1 |
| InChIKey | BEAXRNFXFAMMQH-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine?
The IUPAC name of 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine (CID 21032415) is 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine.
What is the SMILES notation for 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine?
The canonical SMILES for 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine is C[C@H]1CN(c2ccc(N)c(N)c2)CCN1C.
What is the InChIKey of 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine?
The InChIKey is BEAXRNFXFAMMQH-VIFPVBQESA-N. The full InChI is InChI=1S/C12H20N4/c1-9-8-16(6-5-15(9)2)10-3-4-11(13)12(14)7-10/h3-4,7,9H,5-6,8,13-14H2,1-2H3/t9-/m0/s1.
What are the key properties of 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine?
4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine has a molecular weight of 220.32 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine is sourced from PubChem (CID 21032415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).