C12H20N4 — CID 21032415
4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine (PubChem CID 21032415) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine.
| Compound Name | 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 21032415 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-[(3S)-3,4-dimethylpiperazin-1-yl]benzene-1,2-diamine |
| SMILES | C[C@H]1CN(c2ccc(N)c(N)c2)CCN1C |
| InChI | InChI=1S/C12H20N4/c1-9-8-16(6-5-15(9)2)10-3-4-11(13)12(14)7-10/h3-4,7,9H,5-6,8,13-14H2,1-2H3/t9-/m0/s1 |
| InChIKey | BEAXRNFXFAMMQH-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|