C14H20N4O — CID 63609206
3-amino-6-(3,4-dimethylpiperazin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 63609206) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-amino-6-(3,4-dimethylpiperazin-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 3-amino-6-(3,4-dimethylpiperazin-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63609206 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-amino-6-(3,4-dimethylpiperazin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | CC1CN(c2ccc3c(c2)NC(=O)C3N)CCN1C |
| InChI | InChI=1S/C14H20N4O/c1-9-8-18(6-5-17(9)2)10-3-4-11-12(7-10)16-14(19)13(11)15/h3-4,7,9,13H,5-6,8,15H2,1-2H3,(H,16,19) |
| InChIKey | CGTNTBBEAMFTPR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |