C15H23N3 — CID 81214534
7-(3,4-dimethylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 81214534) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 7-(3,4-dimethylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(3,4-dimethylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81214534 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 7-(3,4-dimethylpiperazin-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CN(c2ccc3c(c2)NCCC3)CCN1C |
| InChI | InChI=1S/C15H23N3/c1-12-11-18(9-8-17(12)2)14-6-5-13-4-3-7-16-15(13)10-14/h5-6,10,12,16H,3-4,7-9,11H2,1-2H3 |
| InChIKey | GFOJQOOBEDSAQS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |